C29H29N5O2 — CID 53304181
1-[3-[(1S,2S)-2-hydroxycyclohexyl]-4-oxobenzo[h]quinazolin-6-yl]-4-pyridin-2-ylpiperidine-4-carbonitrile (PubChem CID 53304181) has the molecular formula C29H29N5O2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 1-[3-[(1S,2S)-2-hydroxycyclohexyl]-4-oxobenzo[h]quinazolin-6-yl]-4-pyridin-2-ylpiperidine-4-carbonitrile.
| Compound Name | 1-[3-[(1S,2S)-2-hydroxycyclohexyl]-4-oxobenzo[h]quinazolin-6-yl]-4-pyridin-2-ylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 53304181 |
| Molecular Formula | C29H29N5O2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 1-[3-[(1S,2S)-2-hydroxycyclohexyl]-4-oxobenzo[h]quinazolin-6-yl]-4-pyridin-2-ylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccn2)CCN(c2cc3c(=O)n([C@H]4CCCC[C@@H]4O)cnc3c3ccccc23)CC1 |
| InChI | InChI=1S/C29H29N5O2/c30-18-29(26-11-5-6-14-31-26)12-15-33(16-13-29)24-17-22-27(21-8-2-1-7-20(21)24)32-19-34(28(22)36)23-9-3-4-10-25(23)35/h1-2,5-8,11,14,17,19,23,25,35H,3-4,9-10,12-13,15-16H2/t23-,25-/m0/s1 |
| InChIKey | YRXINNVYHVEEKS-ZCYQVOJMSA-N |
| XLogP | 4.48 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|