C22H39NO3Si — CID 53304296
tri(propan-2-yl)silyl 2-[(9R,9aS)-3-oxo-1,2,5,6,9,9a-hexahydropyrrolo[1,2-a]azepin-9-yl]butanoate (PubChem CID 53304296) has the molecular formula C22H39NO3Si and a molecular weight of 393.64 g/mol. Its IUPAC name is tri(propan-2-yl)silyl 2-[(9R,9aS)-3-oxo-1,2,5,6,9,9a-hexahydropyrrolo[1,2-a]azepin-9-yl]butanoate.
| Compound Name | tri(propan-2-yl)silyl 2-[(9R,9aS)-3-oxo-1,2,5,6,9,9a-hexahydropyrrolo[1,2-a]azepin-9-yl]butanoate |
|---|---|
| PubChem CID | 53304296 |
| Molecular Formula | C22H39NO3Si |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | tri(propan-2-yl)silyl 2-[(9R,9aS)-3-oxo-1,2,5,6,9,9a-hexahydropyrrolo[1,2-a]azepin-9-yl]butanoate |
| SMILES | CCC(C(=O)O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C=CCCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H39NO3Si/c1-8-18(19-11-9-10-14-23-20(19)12-13-21(23)24)22(25)26-27(15(2)3,16(4)5)17(6)7/h9,11,15-20H,8,10,12-14H2,1-7H3/t18?,19-,20+/m1/s1 |
| InChIKey | IKDSYJJMXOEISI-HUSUDBNBSA-N |
| XLogP | 5.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|