About N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine
N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine (PubChem CID 53304340) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine.
Molecular Properties
| Compound Name | N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine |
| PubChem CID | 53304340 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine |
| SMILES | CNCC[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H19NO2/c1-14-9-7-12-8-10-15-13(16-12)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | XOUAHCDKUNMPLM-OLZOCXBDSA-N |
| XLogP | 2.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine?
The IUPAC name of N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine (CID 53304340) is N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine.
What is the SMILES notation for N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine?
The canonical SMILES for N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine is CNCC[C@@H]1CCO[C@H](c2ccccc2)O1.
What is the InChIKey of N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine?
The InChIKey is XOUAHCDKUNMPLM-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H19NO2/c1-14-9-7-12-8-10-15-13(16-12)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12-,13+/m1/s1.
What are the key properties of N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine?
N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine has a molecular weight of 221.30 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine is sourced from PubChem (CID 53304340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).