C14H21NO2 — CID 53304341
N,N-dimethyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine (PubChem CID 53304341) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 53304341 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N,N-dimethyl-2-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]ethanamine |
| SMILES | CN(C)CC[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C14H21NO2/c1-15(2)10-8-13-9-11-16-14(17-13)12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | IGVOGMNWIBGCRX-KGLIPLIRSA-N |
| XLogP | 2.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |