About 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine
2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine (PubChem CID 53304348) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine |
| PubChem CID | 53304348 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine |
| SMILES | CC[C@@]1(c2ccccc2)OCC[C@@H](CCNC)O1 |
| InChI | InChI=1S/C15H23NO2/c1-3-15(13-7-5-4-6-8-13)17-12-10-14(18-15)9-11-16-2/h4-8,14,16H,3,9-12H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | HMAADEFXIZTOAG-HUUCEWRRSA-N |
| XLogP | 2.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine?
The IUPAC name of 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine (CID 53304348) is 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine.
What is the SMILES notation for 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine?
The canonical SMILES for 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine is CC[C@@]1(c2ccccc2)OCC[C@@H](CCNC)O1.
What is the InChIKey of 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine?
The InChIKey is HMAADEFXIZTOAG-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H23NO2/c1-3-15(13-7-5-4-6-8-13)17-12-10-14(18-15)9-11-16-2/h4-8,14,16H,3,9-12H2,1-2H3/t14-,15-/m1/s1.
What are the key properties of 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine?
2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine has a molecular weight of 249.35 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4R)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]-N-methylethanamine is sourced from PubChem (CID 53304348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).