C31H35N5O5 — CID 5330444
7-methoxy-8-[2-(4-methylpiperazin-1-yl)ethoxy]-4-(3,4,5-trimethoxyanilino)benzo[g]quinoline-3-carbonitrile (PubChem CID 5330444) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is 7-methoxy-8-[2-(4-methylpiperazin-1-yl)ethoxy]-4-(3,4,5-trimethoxyanilino)benzo[g]quinoline-3-carbonitrile.
| Compound Name | 7-methoxy-8-[2-(4-methylpiperazin-1-yl)ethoxy]-4-(3,4,5-trimethoxyanilino)benzo[g]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5330444 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 7-methoxy-8-[2-(4-methylpiperazin-1-yl)ethoxy]-4-(3,4,5-trimethoxyanilino)benzo[g]quinoline-3-carbonitrile |
| SMILES | COc1cc2cc3c(Nc4cc(OC)c(OC)c(OC)c4)c(C#N)cnc3cc2cc1OCCN1CCN(C)CC1 |
| InChI | InChI=1S/C31H35N5O5/c1-35-6-8-36(9-7-35)10-11-41-27-15-21-13-25-24(12-20(21)14-26(27)37-2)30(22(18-32)19-33-25)34-23-16-28(38-3)31(40-5)29(17-23)39-4/h12-17,19H,6-11H2,1-5H3,(H,33,34) |
| InChIKey | GPGNRRFWAXPCTG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|