About 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine
3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine (PubChem CID 53304508) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine |
| PubChem CID | 53304508 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine |
| SMILES | NCCC[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H19NO2/c14-9-4-7-12-8-10-15-13(16-12)11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10,14H2/t12-,13+/m1/s1 |
| InChIKey | OCEQACROYVKLBC-OLZOCXBDSA-N |
| XLogP | 2.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
The IUPAC name of 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine (CID 53304508) is 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine.
What is the SMILES notation for 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
The canonical SMILES for 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine is NCCC[C@@H]1CCO[C@H](c2ccccc2)O1.
What is the InChIKey of 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
The InChIKey is OCEQACROYVKLBC-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H19NO2/c14-9-4-7-12-8-10-15-13(16-12)11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10,14H2/t12-,13+/m1/s1.
What are the key properties of 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine has a molecular weight of 221.30 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine is sourced from PubChem (CID 53304508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).