About N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine
N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine (PubChem CID 53304509) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine.
Molecular Properties
| Compound Name | N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine |
| PubChem CID | 53304509 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine |
| SMILES | CNCCC[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C14H21NO2/c1-15-10-5-8-13-9-11-16-14(17-13)12-6-3-2-4-7-12/h2-4,6-7,13-15H,5,8-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | VHMOMQNESQLELI-KGLIPLIRSA-N |
| XLogP | 2.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
The IUPAC name of N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine (CID 53304509) is N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine.
What is the SMILES notation for N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
The canonical SMILES for N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine is CNCCC[C@@H]1CCO[C@H](c2ccccc2)O1.
What is the InChIKey of N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
The InChIKey is VHMOMQNESQLELI-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H21NO2/c1-15-10-5-8-13-9-11-16-14(17-13)12-6-3-2-4-7-12/h2-4,6-7,13-15H,5,8-11H2,1H3/t13-,14+/m1/s1.
What are the key properties of N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine?
N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine has a molecular weight of 235.33 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine is sourced from PubChem (CID 53304509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).