C15H23NO2 — CID 53304510
N,N-dimethyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine (PubChem CID 53304510) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 53304510 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N,N-dimethyl-3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propan-1-amine |
| SMILES | CN(C)CCC[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H23NO2/c1-16(2)11-6-9-14-10-12-17-15(18-14)13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | NJXMZJKKFDXHRC-CABCVRRESA-N |
| XLogP | 2.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |