C19H21N3O5 — CID 5330462
6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine (PubChem CID 5330462) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 5330462 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3cc(OC)c(OC)c(OC)c3)c2cc1OC |
| InChI | InChI=1S/C19H21N3O5/c1-23-14-8-12-13(9-15(14)24-2)20-10-21-19(12)22-11-6-16(25-3)18(27-5)17(7-11)26-4/h6-10H,1-5H3,(H,20,21,22) |
| InChIKey | RNCVPFCGSMNPPO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |