C20H23N3O5 — CID 5330463
N-(4-ethoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 5330463) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-(4-ethoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-(4-ethoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 5330463 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(4-ethoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | CCOc1c(OC)cc(Nc2ncnc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C20H23N3O5/c1-6-28-19-17(26-4)7-12(8-18(19)27-5)23-20-13-9-15(24-2)16(25-3)10-14(13)21-11-22-20/h7-11H,6H2,1-5H3,(H,21,22,23) |
| InChIKey | VECJRCLVOQXPPA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |