About N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine
N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 5330464) has the molecular formula C22H27N3O5
and a molecular weight of 413.47 g/mol. Its IUPAC name is N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine.
Molecular Properties
| Compound Name | N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine |
| PubChem CID | 5330464 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | CCCCOc1c(OC)cc(Nc2ncnc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C22H27N3O5/c1-6-7-8-30-21-19(28-4)9-14(10-20(21)29-5)25-22-15-11-17(26-2)18(27-3)12-16(15)23-13-24-22/h9-13H,6-8H2,1-5H3,(H,23,24,25) |
| InChIKey | ZHIFGBYEQJQNRE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine?
The IUPAC name of N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine (CID 5330464) is N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine.
What is the SMILES notation for N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine?
The canonical SMILES for N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine is CCCCOc1c(OC)cc(Nc2ncnc3cc(OC)c(OC)cc23)cc1OC.
What is the InChIKey of N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine?
The InChIKey is ZHIFGBYEQJQNRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O5/c1-6-7-8-30-21-19(28-4)9-14(10-20(21)29-5)25-22-15-11-17(26-2)18(27-3)12-16(15)23-13-24-22/h9-13H,6-8H2,1-5H3,(H,23,24,25).
What are the key properties of N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine?
N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine has a molecular weight of 413.47 g/mol, XLogP of 4.59, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butoxy-3,5-dimethoxyphenyl)-6,7-dimethoxyquinazolin-4-amine is sourced from PubChem (CID 5330464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).