C20H22N2O5 — CID 5330475
6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine (PubChem CID 5330475) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine.
| Compound Name | 6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine |
|---|---|
| PubChem CID | 5330475 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine |
| SMILES | COc1cc2nccc(Nc3cc(OC)c(OC)c(OC)c3)c2cc1OC |
| InChI | InChI=1S/C20H22N2O5/c1-23-16-10-13-14(6-7-21-15(13)11-17(16)24-2)22-12-8-18(25-3)20(27-5)19(9-12)26-4/h6-11H,1-5H3,(H,21,22) |
| InChIKey | VYPGLYMWNDRFGZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |