C23H26N2O7 — CID 5330476
ethyl 6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carboxylate (PubChem CID 5330476) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is ethyl 6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carboxylate.
| Compound Name | ethyl 6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 5330476 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | ethyl 6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OC)c(OC)cc2c1Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O7/c1-7-32-23(26)15-12-24-16-11-18(28-3)17(27-2)10-14(16)21(15)25-13-8-19(29-4)22(31-6)20(9-13)30-5/h8-12H,7H2,1-6H3,(H,24,25) |
| InChIKey | NSPRKBCGBIGEDX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |