C16H26O6 — CID 53304975
[(1S,2S,4R,6R)-2-(3-methylbutoxy)-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 53304975) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(1S,2S,4R,6R)-2-(3-methylbutoxy)-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,2S,4R,6R)-2-(3-methylbutoxy)-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 53304975 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [(1S,2S,4R,6R)-2-(3-methylbutoxy)-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)CCO[C@H]1O[C@H](COC(=O)C(C)(C)C)C(=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C16H26O6/c1-9(2)6-7-19-14-13-12(22-13)11(17)10(21-14)8-20-15(18)16(3,4)5/h9-10,12-14H,6-8H2,1-5H3/t10-,12+,13+,14+/m1/s1 |
| InChIKey | GPOYEWFSYVGECW-SAXRGWBVSA-N |
| XLogP | 1.70 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|