C19H38O3Si — CID 53305074
triethyl-[(4R,5S)-5-(methoxymethoxy)-9-methyldeca-1,8-dien-4-yl]oxysilane (PubChem CID 53305074) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is triethyl-[(4R,5S)-5-(methoxymethoxy)-9-methyldeca-1,8-dien-4-yl]oxysilane.
| Compound Name | triethyl-[(4R,5S)-5-(methoxymethoxy)-9-methyldeca-1,8-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 53305074 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | triethyl-[(4R,5S)-5-(methoxymethoxy)-9-methyldeca-1,8-dien-4-yl]oxysilane |
| SMILES | C=CC[C@@H](O[Si](CC)(CC)CC)[C@H](CCC=C(C)C)OCOC |
| InChI | InChI=1S/C19H38O3Si/c1-8-13-19(22-23(9-2,10-3)11-4)18(21-16-20-7)15-12-14-17(5)6/h8,14,18-19H,1,9-13,15-16H2,2-7H3/t18-,19+/m0/s1 |
| InChIKey | JLYXZEFPQLUCEV-RBUKOAKNSA-N |
| XLogP | 5.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|