C16H30O4 — CID 53305121
(2R,3S,6S)-6-decoxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 53305121) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is (2R,3S,6S)-6-decoxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6S)-6-decoxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 53305121 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (2R,3S,6S)-6-decoxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCCCCCCCCCO[C@@H]1C=C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H30O4/c1-2-3-4-5-6-7-8-9-12-19-16-11-10-14(18)15(13-17)20-16/h10-11,14-18H,2-9,12-13H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | QUVMOROOHBHLLT-XHSDSOJGSA-N |
| XLogP | 2.78 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|