C13H26O4 — CID 53305210
(2S,4R,5S)-5-(methoxymethoxy)-9-methyldec-8-ene-2,4-diol (PubChem CID 53305210) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2S,4R,5S)-5-(methoxymethoxy)-9-methyldec-8-ene-2,4-diol.
| Compound Name | (2S,4R,5S)-5-(methoxymethoxy)-9-methyldec-8-ene-2,4-diol |
|---|---|
| PubChem CID | 53305210 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (2S,4R,5S)-5-(methoxymethoxy)-9-methyldec-8-ene-2,4-diol |
| SMILES | COCO[C@@H](CCC=C(C)C)[C@H](O)C[C@H](C)O |
| InChI | InChI=1S/C13H26O4/c1-10(2)6-5-7-13(17-9-16-4)12(15)8-11(3)14/h6,11-15H,5,7-9H2,1-4H3/t11-,12+,13-/m0/s1 |
| InChIKey | KNBZDYHZBKUFFG-XQQFMLRXSA-N |
| XLogP | 1.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|