C15H26O5 — CID 53305212
[(2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-yl] acetate (PubChem CID 53305212) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-yl] acetate.
| Compound Name | [(2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-yl] acetate |
|---|---|
| PubChem CID | 53305212 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [(2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-yl] acetate |
| SMILES | C=CC[C@@H]1CC[C@H](OCOC)[C@@H](C[C@H](C)OC(C)=O)O1 |
| InChI | InChI=1S/C15H26O5/c1-5-6-13-7-8-14(18-10-17-4)15(20-13)9-11(2)19-12(3)16/h5,11,13-15H,1,6-10H2,2-4H3/t11-,13+,14-,15+/m0/s1 |
| InChIKey | CJCOVAAPANJGCA-PMOUVXMZSA-N |
| XLogP | 2.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|