C13H24O4 — CID 53305213
(2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-ol (PubChem CID 53305213) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-ol.
| Compound Name | (2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 53305213 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (2S)-1-[(2R,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]propan-2-ol |
| SMILES | C=CC[C@@H]1CC[C@H](OCOC)[C@@H](C[C@H](C)O)O1 |
| InChI | InChI=1S/C13H24O4/c1-4-5-11-6-7-12(16-9-15-3)13(17-11)8-10(2)14/h4,10-14H,1,5-9H2,2-3H3/t10-,11+,12-,13+/m0/s1 |
| InChIKey | QVGZVZFITFRIFS-QNWHQSFQSA-N |
| XLogP | 1.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|