About [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate
[(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate (PubChem CID 53305415) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate |
| PubChem CID | 53305415 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C12H18O5/c1-8(13)15-7-10-9(14)5-6-11(16-10)17-12(2,3)4/h5-6,10-11H,7H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | RQWKVPADTWOEFO-GHMZBOCLSA-N |
| XLogP | 1.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate?
The IUPAC name of [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate (CID 53305415) is [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate.
What is the SMILES notation for [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate?
The canonical SMILES for [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate is CC(=O)OC[C@H]1O[C@H](OC(C)(C)C)C=CC1=O.
What is the InChIKey of [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate?
The InChIKey is RQWKVPADTWOEFO-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H18O5/c1-8(13)15-7-10-9(14)5-6-11(16-10)17-12(2,3)4/h5-6,10-11H,7H2,1-4H3/t10-,11-/m1/s1.
What are the key properties of [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate?
[(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate has a molecular weight of 242.27 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,6R)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2H-pyran-6-yl]methyl acetate is sourced from PubChem (CID 53305415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).