About [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate
[2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate (PubChem CID 5330550) has the molecular formula C23H16N2O3S
and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate |
| PubChem CID | 5330550 |
| Molecular Formula | C23H16N2O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate |
| SMILES | O=C(Cc1cccs1)Oc1ccc2[nH]c(C(=O)c3cc4ccccc4[nH]3)cc2c1 |
| InChI | InChI=1S/C23H16N2O3S/c26-22(13-17-5-3-9-29-17)28-16-7-8-19-15(10-16)12-21(25-19)23(27)20-11-14-4-1-2-6-18(14)24-20/h1-12,24-25H,13H2 |
| InChIKey | XTOWMFGOCVBOQW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate?
The IUPAC name of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate (CID 5330550) is [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate.
What is the SMILES notation for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate?
The canonical SMILES for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate is O=C(Cc1cccs1)Oc1ccc2[nH]c(C(=O)c3cc4ccccc4[nH]3)cc2c1.
What is the InChIKey of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate?
The InChIKey is XTOWMFGOCVBOQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O3S/c26-22(13-17-5-3-9-29-17)28-16-7-8-19-15(10-16)12-21(25-19)23(27)20-11-14-4-1-2-6-18(14)24-20/h1-12,24-25H,13H2.
What are the key properties of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate?
[2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate has a molecular weight of 400.46 g/mol, XLogP of 5.09, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-thiophen-2-ylacetate is sourced from PubChem (CID 5330550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).