About [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate
[2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate (PubChem CID 5330562) has the molecular formula C27H17N3O3
and a molecular weight of 431.45 g/mol. Its IUPAC name is [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate.
Molecular Properties
| Compound Name | [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate |
| PubChem CID | 5330562 |
| Molecular Formula | C27H17N3O3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate |
| SMILES | O=C(Oc1ccc2[nH]c(C(=O)c3cc4ccccc4[nH]3)cc2c1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C27H17N3O3/c31-26(24-14-17-6-2-4-8-21(17)29-24)25-15-18-13-19(10-12-22(18)30-25)33-27(32)23-11-9-16-5-1-3-7-20(16)28-23/h1-15,29-30H |
| InChIKey | QGYRKVYFLNADDX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate?
The IUPAC name of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate (CID 5330562) is [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate.
What is the SMILES notation for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate?
The canonical SMILES for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate is O=C(Oc1ccc2[nH]c(C(=O)c3cc4ccccc4[nH]3)cc2c1)c1ccc2ccccc2n1.
What is the InChIKey of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate?
The InChIKey is QGYRKVYFLNADDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17N3O3/c31-26(24-14-17-6-2-4-8-21(17)29-24)25-15-18-13-19(10-12-22(18)30-25)33-27(32)23-11-9-16-5-1-3-7-20(16)28-23/h1-15,29-30H.
What are the key properties of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate?
[2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate has a molecular weight of 431.45 g/mol, XLogP of 5.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] quinoline-2-carboxylate is sourced from PubChem (CID 5330562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).