C25H35NO5 — CID 53305688
tert-butyl (2R,3R,4S,5S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,4,5-trihydroxyhexanoate (PubChem CID 53305688) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S,5S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,4,5-trihydroxyhexanoate.
| Compound Name | tert-butyl (2R,3R,4S,5S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,4,5-trihydroxyhexanoate |
|---|---|
| PubChem CID | 53305688 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | tert-butyl (2R,3R,4S,5S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,4,5-trihydroxyhexanoate |
| SMILES | C[C@H](O)[C@@H](O)[C@H]([C@@H](O)C(=O)OC(C)(C)C)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H35NO5/c1-17(20-14-10-7-11-15-20)26(16-19-12-8-6-9-13-19)21(22(28)18(2)27)23(29)24(30)31-25(3,4)5/h6-15,17-18,21-23,27-29H,16H2,1-5H3/t17-,18+,21-,22-,23-/m1/s1 |
| InChIKey | OYBMJPQAIHAEEA-NQDIBGKZSA-N |
| XLogP | 3.06 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |