C25H25ClN6O2 — CID 5330583
1-[(9bS)-5-oxo-1,2,3,9b-tetrahydropyrrolo[2,1-a]isoindol-9-yl]-3-[5-[[[(2S)-5-chloro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-1H-pyrazol-3-yl]urea (PubChem CID 5330583) has the molecular formula C25H25ClN6O2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 1-[(9bS)-5-oxo-1,2,3,9b-tetrahydropyrrolo[2,1-a]isoindol-9-yl]-3-[5-[[[(2S)-5-chloro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-1H-pyrazol-3-yl]urea.
| Compound Name | 1-[(9bS)-5-oxo-1,2,3,9b-tetrahydropyrrolo[2,1-a]isoindol-9-yl]-3-[5-[[[(2S)-5-chloro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-1H-pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 5330583 |
| Molecular Formula | C25H25ClN6O2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 1-[(9bS)-5-oxo-1,2,3,9b-tetrahydropyrrolo[2,1-a]isoindol-9-yl]-3-[5-[[[(2S)-5-chloro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-1H-pyrazol-3-yl]urea |
| SMILES | O=C(Nc1cc(CN[C@H]2Cc3ccc(Cl)cc3C2)[nH]n1)Nc1cccc2c1[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C25H25ClN6O2/c26-16-7-6-14-10-17(11-15(14)9-16)27-13-18-12-22(31-30-18)29-25(34)28-20-4-1-3-19-23(20)21-5-2-8-32(21)24(19)33/h1,3-4,6-7,9,12,17,21,27H,2,5,8,10-11,13H2,(H3,28,29,30,31,34)/t17-,21-/m0/s1 |
| InChIKey | CGHADMRBCNGDHX-UWJYYQICSA-N |
| XLogP | 4.25 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |