C21H16Cl2N6O3S — CID 5330609
2-[4-[[6-(2,6-dichlorobenzoyl)imidazo[1,2-a]pyridin-2-yl]amino]phenyl]sulfonylguanidine (PubChem CID 5330609) has the molecular formula C21H16Cl2N6O3S and a molecular weight of 503.37 g/mol. Its IUPAC name is 2-[4-[[6-(2,6-dichlorobenzoyl)imidazo[1,2-a]pyridin-2-yl]amino]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[[6-(2,6-dichlorobenzoyl)imidazo[1,2-a]pyridin-2-yl]amino]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 5330609 |
| Molecular Formula | C21H16Cl2N6O3S |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-[4-[[6-(2,6-dichlorobenzoyl)imidazo[1,2-a]pyridin-2-yl]amino]phenyl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(Nc2cn3cc(C(=O)c4c(Cl)cccc4Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C21H16Cl2N6O3S/c22-15-2-1-3-16(23)19(15)20(30)12-4-9-18-27-17(11-29(18)10-12)26-13-5-7-14(8-6-13)33(31,32)28-21(24)25/h1-11,26H,(H4,24,25,28) |
| InChIKey | KBFNBMAXWKLLHH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|