C21H11F4N3OS — CID 5330620
[2-amino-3-(2,6-difluorobenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone (PubChem CID 5330620) has the molecular formula C21H11F4N3OS and a molecular weight of 429.40 g/mol. Its IUPAC name is [2-amino-3-(2,6-difluorobenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone.
| Compound Name | [2-amino-3-(2,6-difluorobenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 5330620 |
| Molecular Formula | C21H11F4N3OS |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | [2-amino-3-(2,6-difluorobenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone |
| SMILES | Nc1nc2ccc(C(=O)c3c(F)cccc3F)cn2c1C(=S)c1c(F)cccc1F |
| InChI | InChI=1S/C21H11F4N3OS/c22-11-3-1-4-12(23)16(11)19(29)10-7-8-15-27-21(26)18(28(15)9-10)20(30)17-13(24)5-2-6-14(17)25/h1-9H,26H2 |
| InChIKey | HARCNHPDYDKMHE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|