C22H13F4N3O2S — CID 5330621
[2-amino-3-(2,6-difluoro-4-methoxybenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone (PubChem CID 5330621) has the molecular formula C22H13F4N3O2S and a molecular weight of 459.42 g/mol. Its IUPAC name is [2-amino-3-(2,6-difluoro-4-methoxybenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone.
| Compound Name | [2-amino-3-(2,6-difluoro-4-methoxybenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 5330621 |
| Molecular Formula | C22H13F4N3O2S |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | [2-amino-3-(2,6-difluoro-4-methoxybenzenecarbothioyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone |
| SMILES | COc1cc(F)c(C(=S)c2c(N)nc3ccc(C(=O)c4c(F)cccc4F)cn23)c(F)c1 |
| InChI | InChI=1S/C22H13F4N3O2S/c1-31-11-7-14(25)18(15(26)8-11)21(32)19-22(27)28-16-6-5-10(9-29(16)19)20(30)17-12(23)3-2-4-13(17)24/h2-9H,27H2,1H3 |
| InChIKey | TXYDVOWCSZIRIZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|