About [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone
[2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone (PubChem CID 5330636) has the molecular formula C19H11F2N3O2S
and a molecular weight of 383.38 g/mol. Its IUPAC name is [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone.
Molecular Properties
| Compound Name | [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone |
| PubChem CID | 5330636 |
| Molecular Formula | C19H11F2N3O2S |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone |
| SMILES | Nc1nc2ccc(C(=O)c3c(F)cccc3F)cn2c1C(=O)c1cccs1 |
| InChI | InChI=1S/C19H11F2N3O2S/c20-11-3-1-4-12(21)15(11)17(25)10-6-7-14-23-19(22)16(24(14)9-10)18(26)13-5-2-8-27-13/h1-9H,22H2 |
| InChIKey | JXZDETNFHHPYMT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone?
The IUPAC name of [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone (CID 5330636) is [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone.
What is the SMILES notation for [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone?
The canonical SMILES for [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone is Nc1nc2ccc(C(=O)c3c(F)cccc3F)cn2c1C(=O)c1cccs1.
What is the InChIKey of [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone?
The InChIKey is JXZDETNFHHPYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F2N3O2S/c20-11-3-1-4-12(21)15(11)17(25)10-6-7-14-23-19(22)16(24(14)9-10)18(26)13-5-2-8-27-13/h1-9H,22H2.
What are the key properties of [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone?
[2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone has a molecular weight of 383.38 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-3-(thiophene-2-carbonyl)imidazo[1,2-a]pyridin-6-yl]-(2,6-difluorophenyl)methanone is sourced from PubChem (CID 5330636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).