About 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea
1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea (PubChem CID 53306556) has the molecular formula C23H17ClN4O3S
and a molecular weight of 464.93 g/mol. Its IUPAC name is 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea.
Molecular Properties
| Compound Name | 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea |
| PubChem CID | 53306556 |
| Molecular Formula | C23H17ClN4O3S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea |
| SMILES | O=C(NC(=S)Nc1ccccc1Cl)Nc1ccc2c(c1)C(=O)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H17ClN4O3S/c24-17-8-4-5-9-18(17)26-23(32)27-22(31)25-15-10-11-19-16(12-15)20(29)21(30)28(19)13-14-6-2-1-3-7-14/h1-12H,13H2,(H3,25,26,27,31,32) |
| InChIKey | KNUPFZSFBCKBNV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea?
The IUPAC name of 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea (CID 53306556) is 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea.
What is the SMILES notation for 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea?
The canonical SMILES for 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea is O=C(NC(=S)Nc1ccccc1Cl)Nc1ccc2c(c1)C(=O)C(=O)N2Cc1ccccc1.
What is the InChIKey of 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea?
The InChIKey is KNUPFZSFBCKBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17ClN4O3S/c24-17-8-4-5-9-18(17)26-23(32)27-22(31)25-15-10-11-19-16(12-15)20(29)21(30)28(19)13-14-6-2-1-3-7-14/h1-12H,13H2,(H3,25,26,27,31,32).
What are the key properties of 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea?
1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea has a molecular weight of 464.93 g/mol, XLogP of 4.59, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzyl-2,3-dioxoindol-5-yl)-3-[(2-chlorophenyl)carbamothioyl]urea is sourced from PubChem (CID 53306556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).