C41H38N2O4 — CID 53306602
benzyl 1-[3,4-bis(phenylmethoxy)phenyl]-6-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 53306602) has the molecular formula C41H38N2O4 and a molecular weight of 622.77 g/mol. Its IUPAC name is benzyl 1-[3,4-bis(phenylmethoxy)phenyl]-6-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | benzyl 1-[3,4-bis(phenylmethoxy)phenyl]-6-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 53306602 |
| Molecular Formula | C41H38N2O4 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | benzyl 1-[3,4-bis(phenylmethoxy)phenyl]-6-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCc1ccc2[nH]c3c(c2c1)CCN(C(=O)OCc1ccccc1)C3c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C41H38N2O4/c1-2-29-18-20-36-35(24-29)34-22-23-43(41(44)47-28-32-16-10-5-11-17-32)40(39(34)42-36)33-19-21-37(45-26-30-12-6-3-7-13-30)38(25-33)46-27-31-14-8-4-9-15-31/h3-21,24-25,40,42H,2,22-23,26-28H2,1H3 |
| InChIKey | YWXSOIGDBIFOAS-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|