C14H25O7P — CID 53306623
(3aR,6R,6aR)-6-[(E)-3-diethoxyphosphorylprop-1-enyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 53306623) has the molecular formula C14H25O7P and a molecular weight of 336.32 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-[(E)-3-diethoxyphosphorylprop-1-enyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,6R,6aR)-6-[(E)-3-diethoxyphosphorylprop-1-enyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 53306623 |
| Molecular Formula | C14H25O7P |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3aR,6R,6aR)-6-[(E)-3-diethoxyphosphorylprop-1-enyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CCOP(=O)(C/C=C/[C@@]1(O)CO[C@@H]2OC(C)(C)O[C@@H]21)OCC |
| InChI | InChI=1S/C14H25O7P/c1-5-18-22(16,19-6-2)9-7-8-14(15)10-17-12-11(14)20-13(3,4)21-12/h7-8,11-12,15H,5-6,9-10H2,1-4H3/b8-7+/t11-,12+,14+/m0/s1 |
| InChIKey | VJZZEZKDXNBLOH-HAUDSGCWSA-N |
| XLogP | 2.05 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|