C22H13N3O2 — CID 5330664
1,4,14-triazaheptacyclo[16.6.1.02,17.03,11.05,10.012,16.022,25]pentacosa-2,5,7,9,11,16,18,20,22(25)-nonaene-13,15-dione (PubChem CID 5330664) has the molecular formula C22H13N3O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1,4,14-triazaheptacyclo[16.6.1.02,17.03,11.05,10.012,16.022,25]pentacosa-2,5,7,9,11,16,18,20,22(25)-nonaene-13,15-dione.
| Compound Name | 1,4,14-triazaheptacyclo[16.6.1.02,17.03,11.05,10.012,16.022,25]pentacosa-2,5,7,9,11,16,18,20,22(25)-nonaene-13,15-dione |
|---|---|
| PubChem CID | 5330664 |
| Molecular Formula | C22H13N3O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 1,4,14-triazaheptacyclo[16.6.1.02,17.03,11.05,10.012,16.022,25]pentacosa-2,5,7,9,11,16,18,20,22(25)-nonaene-13,15-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1c2c2cccc3c2n1CC3 |
| InChI | InChI=1S/C22H13N3O2/c26-21-16-14-11-5-1-2-7-13(11)23-18(14)20-15(17(16)22(27)24-21)12-6-3-4-10-8-9-25(20)19(10)12/h1-7,23H,8-9H2,(H,24,26,27) |
| InChIKey | WWRRUUZFYZQGIO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|