C24H14F3N3O2 — CID 5330675
7-(trifluoromethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione (PubChem CID 5330675) has the molecular formula C24H14F3N3O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione.
| Compound Name | 7-(trifluoromethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione |
|---|---|
| PubChem CID | 5330675 |
| Molecular Formula | C24H14F3N3O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 7-(trifluoromethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccc(C(F)(F)F)cc3[nH]c1c1c2c2cccc3c2n1CCC3 |
| InChI | InChI=1S/C24H14F3N3O2/c25-24(26,27)11-6-7-12-14(9-11)28-19-15(12)17-18(23(32)29-22(17)31)16-13-5-1-3-10-4-2-8-30(20(10)13)21(16)19/h1,3,5-7,9,28H,2,4,8H2,(H,29,31,32) |
| InChIKey | YCJQPXOFHDMQBR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|