C28H18N4O2 — CID 5330677
7-pyridin-3-yl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione (PubChem CID 5330677) has the molecular formula C28H18N4O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 7-pyridin-3-yl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione.
| Compound Name | 7-pyridin-3-yl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione |
|---|---|
| PubChem CID | 5330677 |
| Molecular Formula | C28H18N4O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 7-pyridin-3-yl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccc(-c4cccnc4)cc3[nH]c1c1c2c2cccc3c2n1CCC3 |
| InChI | InChI=1S/C28H18N4O2/c33-27-22-20-17-9-8-15(16-5-2-10-29-13-16)12-19(17)30-24(20)26-21(23(22)28(34)31-27)18-7-1-4-14-6-3-11-32(26)25(14)18/h1-2,4-5,7-10,12-13,30H,3,6,11H2,(H,31,33,34) |
| InChIKey | AHYFSTZCDSRVKK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|