C24H18N4O2 — CID 5330680
7-(aminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione (PubChem CID 5330680) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 7-(aminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione.
| Compound Name | 7-(aminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione |
|---|---|
| PubChem CID | 5330680 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 7-(aminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione |
| SMILES | NCc1ccc2c(c1)[nH]c1c2c2c(c3c4cccc5c4n(c13)CCC5)C(=O)NC2=O |
| InChI | InChI=1S/C24H18N4O2/c25-10-11-6-7-13-15(9-11)26-20-16(13)18-19(24(30)27-23(18)29)17-14-5-1-3-12-4-2-8-28(21(12)14)22(17)20/h1,3,5-7,9,26H,2,4,8,10,25H2,(H,27,29,30) |
| InChIKey | FIBFIQARGKNQJY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|