About 2-bromo-N,N-dihexylpropanamide
2-bromo-N,N-dihexylpropanamide (PubChem CID 533069) has the molecular formula C15H30BrNO
and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-bromo-N,N-dihexylpropanamide.
Molecular Properties
| Compound Name | 2-bromo-N,N-dihexylpropanamide |
| PubChem CID | 533069 |
| Molecular Formula | C15H30BrNO |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-bromo-N,N-dihexylpropanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C(C)Br |
| InChI | InChI=1S/C15H30BrNO/c1-4-6-8-10-12-17(15(18)14(3)16)13-11-9-7-5-2/h14H,4-13H2,1-3H3 |
| InChIKey | WRVBRLZMYIGDCH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-dihexylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-dihexylpropanamide?
The IUPAC name of 2-bromo-N,N-dihexylpropanamide (CID 533069) is 2-bromo-N,N-dihexylpropanamide.
What is the SMILES notation for 2-bromo-N,N-dihexylpropanamide?
The canonical SMILES for 2-bromo-N,N-dihexylpropanamide is CCCCCCN(CCCCCC)C(=O)C(C)Br.
What is the InChIKey of 2-bromo-N,N-dihexylpropanamide?
The InChIKey is WRVBRLZMYIGDCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30BrNO/c1-4-6-8-10-12-17(15(18)14(3)16)13-11-9-7-5-2/h14H,4-13H2,1-3H3.
What are the key properties of 2-bromo-N,N-dihexylpropanamide?
2-bromo-N,N-dihexylpropanamide has a molecular weight of 320.31 g/mol, XLogP of 4.76, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-dihexylpropanamide is sourced from PubChem (CID 533069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).