C25H20ClFN4O2 — CID 5330702
7-fluoro-24-(methylaminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione;hydrochloride (PubChem CID 5330702) has the molecular formula C25H20ClFN4O2 and a molecular weight of 462.91 g/mol. Its IUPAC name is 7-fluoro-24-(methylaminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione;hydrochloride.
| Compound Name | 7-fluoro-24-(methylaminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione;hydrochloride |
|---|---|
| PubChem CID | 5330702 |
| Molecular Formula | C25H20ClFN4O2 |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 7-fluoro-24-(methylaminomethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5(10),6,8,11,16,18,20,22(26)-nonaene-13,15-dione;hydrochloride |
| SMILES | CNCC1Cc2cccc3c4c5c(c6c7ccc(F)cc7[nH]c6c4n(c23)C1)C(=O)NC5=O.Cl |
| InChI | InChI=1S/C25H19FN4O2.ClH/c1-27-9-11-7-12-3-2-4-15-18-20-19(24(31)29-25(20)32)17-14-6-5-13(26)8-16(14)28-21(17)23(18)30(10-11)22(12)15;/h2-6,8,11,27-28H,7,9-10H2,1H3,(H,29,31,32);1H |
| InChIKey | XEKDDEDKBSTPLA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|