About 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione
3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 5330715) has the molecular formula C22H17N3O4
and a molecular weight of 387.40 g/mol. Its IUPAC name is 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| PubChem CID | 5330715 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2c(C3=C(c4c[nH]c5cc(OC)ccc45)C(=O)NC3=O)c[nH]c2c1 |
| InChI | InChI=1S/C22H17N3O4/c1-28-11-3-5-13-15(9-23-17(13)7-11)19-20(22(27)25-21(19)26)16-10-24-18-8-12(29-2)4-6-14(16)18/h3-10,23-24H,1-2H3,(H,25,26,27) |
| InChIKey | IUBVDRHAWOAKOU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione?
The IUPAC name of 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione (CID 5330715) is 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione.
What is the SMILES notation for 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione?
The canonical SMILES for 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione is COc1ccc2c(C3=C(c4c[nH]c5cc(OC)ccc45)C(=O)NC3=O)c[nH]c2c1.
What is the InChIKey of 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione?
The InChIKey is IUBVDRHAWOAKOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O4/c1-28-11-3-5-13-15(9-23-17(13)7-11)19-20(22(27)25-21(19)26)16-10-24-18-8-12(29-2)4-6-14(16)18/h3-10,23-24H,1-2H3,(H,25,26,27).
What are the key properties of 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione?
3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione has a molecular weight of 387.40 g/mol, XLogP of 3.23, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(6-methoxy-1H-indol-3-yl)pyrrole-2,5-dione is sourced from PubChem (CID 5330715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).