C16H18Cl3N5O2 — CID 53307395
(1E)-1-[amino-(3-chloro-4-methoxyanilino)methylidene]-2-(3-chloro-4-methoxyphenyl)guanidine;hydrochloride (PubChem CID 53307395) has the molecular formula C16H18Cl3N5O2 and a molecular weight of 418.71 g/mol. Its IUPAC name is (1E)-1-[amino-(3-chloro-4-methoxyanilino)methylidene]-2-(3-chloro-4-methoxyphenyl)guanidine;hydrochloride.
| Compound Name | (1E)-1-[amino-(3-chloro-4-methoxyanilino)methylidene]-2-(3-chloro-4-methoxyphenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 53307395 |
| Molecular Formula | C16H18Cl3N5O2 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | (1E)-1-[amino-(3-chloro-4-methoxyanilino)methylidene]-2-(3-chloro-4-methoxyphenyl)guanidine;hydrochloride |
| SMILES | COc1ccc(/N=C(N)/N=C(\N)Nc2ccc(OC)c(Cl)c2)cc1Cl.Cl |
| InChI | InChI=1S/C16H17Cl2N5O2.ClH/c1-24-13-5-3-9(7-11(13)17)21-15(19)23-16(20)22-10-4-6-14(25-2)12(18)8-10;/h3-8H,1-2H3,(H5,19,20,21,22,23);1H |
| InChIKey | KCHFAFQFECBBTG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|