C27H17N3O3 — CID 5330742
6-phenylmethoxy-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione (PubChem CID 5330742) has the molecular formula C27H17N3O3 and a molecular weight of 431.45 g/mol. Its IUPAC name is 6-phenylmethoxy-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione.
| Compound Name | 6-phenylmethoxy-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione |
|---|---|
| PubChem CID | 5330742 |
| Molecular Formula | C27H17N3O3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 6-phenylmethoxy-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c(ccc3cc[nH]c31)c1[nH]c3cc(OCc4ccccc4)ccc3c21 |
| InChI | InChI=1S/C27H17N3O3/c31-26-22-20-17-9-7-16(33-13-14-4-2-1-3-5-14)12-19(17)29-25(20)18-8-6-15-10-11-28-24(15)21(18)23(22)27(32)30-26/h1-12,28-29H,13H2,(H,30,31,32) |
| InChIKey | SRXURAFRZBACMR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|