C15H26O5 — CID 53307440
(2R,3S,6E,8R,9R)-3,8-dihydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 53307440) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2R,3S,6E,8R,9R)-3,8-dihydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,3S,6E,8R,9R)-3,8-dihydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 53307440 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2R,3S,6E,8R,9R)-3,8-dihydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | C[C@H](O)CCC[C@H]1OC(=O)[C@H](C)[C@H](O)/C=C/CC[C@@H]1O |
| InChI | InChI=1S/C15H26O5/c1-10(16)6-5-9-14-13(18)8-4-3-7-12(17)11(2)15(19)20-14/h3,7,10-14,16-18H,4-6,8-9H2,1-2H3/b7-3+/t10-,11+,12+,13-,14+/m0/s1 |
| InChIKey | ATNGVHJGYIWYSL-BSJDXJPLSA-N |
| XLogP | 1.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|