C17H28O6 — CID 53307441
[(2R,3S,6E,8R,9R)-3-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate (PubChem CID 53307441) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2R,3S,6E,8R,9R)-3-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate.
| Compound Name | [(2R,3S,6E,8R,9R)-3-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate |
|---|---|
| PubChem CID | 53307441 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(2R,3S,6E,8R,9R)-3-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C/CC[C@H](O)[C@@H](CCC[C@H](C)O)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C17H28O6/c1-11(18)7-6-10-16-14(20)8-4-5-9-15(22-13(3)19)12(2)17(21)23-16/h5,9,11-12,14-16,18,20H,4,6-8,10H2,1-3H3/b9-5+/t11-,12+,14-,15+,16+/m0/s1 |
| InChIKey | ONOZVJYZKJMWKR-RJLSGXJCSA-N |
| XLogP | 1.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|