C19H30O7 — CID 53307442
[(2R,3S,6E,8R,9R)-2-[(4S)-4-acetyloxypentyl]-3-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate (PubChem CID 53307442) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is [(2R,3S,6E,8R,9R)-2-[(4S)-4-acetyloxypentyl]-3-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate.
| Compound Name | [(2R,3S,6E,8R,9R)-2-[(4S)-4-acetyloxypentyl]-3-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate |
|---|---|
| PubChem CID | 53307442 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(2R,3S,6E,8R,9R)-2-[(4S)-4-acetyloxypentyl]-3-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)CCC[C@H]1OC(=O)[C@H](C)[C@H](OC(C)=O)/C=C/CC[C@@H]1O |
| InChI | InChI=1S/C19H30O7/c1-12(24-14(3)20)8-7-11-18-16(22)9-5-6-10-17(25-15(4)21)13(2)19(23)26-18/h6,10,12-13,16-18,22H,5,7-9,11H2,1-4H3/b10-6+/t12-,13+,16-,17+,18+/m0/s1 |
| InChIKey | ZIOYEJIHNQOIKS-LYKZPQITSA-N |
| XLogP | 2.30 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|