C23H17N3O3 — CID 5330746
5-(2-hydroxyethyl)-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione (PubChem CID 5330746) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione.
| Compound Name | 5-(2-hydroxyethyl)-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione |
|---|---|
| PubChem CID | 5330746 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 5-(2-hydroxyethyl)-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione |
| SMILES | Cn1ccc2ccc3c4[nH]c5c(CCO)cccc5c4c4c(c3c21)C(=O)NC4=O |
| InChI | InChI=1S/C23H17N3O3/c1-26-9-7-12-5-6-14-16(21(12)26)18-17(22(28)25-23(18)29)15-13-4-2-3-11(8-10-27)19(13)24-20(14)15/h2-7,9,24,27H,8,10H2,1H3,(H,25,28,29) |
| InChIKey | YTULSWGTQZHYAW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|