C17H28O6 — CID 53307522
[(2S)-5-[(2R,3S,6E,8R,9R)-3,8-dihydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate (PubChem CID 53307522) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2S)-5-[(2R,3S,6E,8R,9R)-3,8-dihydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate.
| Compound Name | [(2S)-5-[(2R,3S,6E,8R,9R)-3,8-dihydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate |
|---|---|
| PubChem CID | 53307522 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(2S)-5-[(2R,3S,6E,8R,9R)-3,8-dihydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)CCC[C@H]1OC(=O)[C@H](C)[C@H](O)/C=C/CC[C@@H]1O |
| InChI | InChI=1S/C17H28O6/c1-11(22-13(3)18)7-6-10-16-15(20)9-5-4-8-14(19)12(2)17(21)23-16/h4,8,11-12,14-16,19-20H,5-7,9-10H2,1-3H3/b8-4+/t11-,12+,14+,15-,16+/m0/s1 |
| InChIKey | OQYOXNVWVYVMKJ-DLCLIBPNSA-N |
| XLogP | 1.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|