C15H26O4 — CID 53307524
(2S,6E,8R,9R)-8-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 53307524) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2S,6E,8R,9R)-8-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (2S,6E,8R,9R)-8-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 53307524 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2S,6E,8R,9R)-8-hydroxy-2-[(4S)-4-hydroxypentyl]-9-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | C[C@H](O)CCC[C@@H]1CCC/C=C/[C@@H](O)[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C15H26O4/c1-11(16)7-6-9-13-8-4-3-5-10-14(17)12(2)15(18)19-13/h5,10-14,16-17H,3-4,6-9H2,1-2H3/b10-5+/t11-,12+,13-,14+/m0/s1 |
| InChIKey | YMGQERYDNJZEPK-HXQQQQEKSA-N |
| XLogP | 2.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|