C17H28O5 — CID 53307525
[(2S)-5-[(2S,6E,8R,9R)-8-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate (PubChem CID 53307525) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2S)-5-[(2S,6E,8R,9R)-8-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate.
| Compound Name | [(2S)-5-[(2S,6E,8R,9R)-8-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate |
|---|---|
| PubChem CID | 53307525 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(2S)-5-[(2S,6E,8R,9R)-8-hydroxy-9-methyl-10-oxo-2,3,4,5,8,9-hexahydrooxecin-2-yl]pentan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)CCC[C@@H]1CCC/C=C/[C@@H](O)[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C17H28O5/c1-12(21-14(3)18)8-7-10-15-9-5-4-6-11-16(19)13(2)17(20)22-15/h6,11-13,15-16,19H,4-5,7-10H2,1-3H3/b11-6+/t12-,13+,15-,16+/m0/s1 |
| InChIKey | HVIXFJUWWGYPPJ-WBVZEZCUSA-N |
| XLogP | 2.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|