About 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide
4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide (PubChem CID 53307620) has the molecular formula C12H13FO2S
and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide.
Molecular Properties
| Compound Name | 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| PubChem CID | 53307620 |
| Molecular Formula | C12H13FO2S |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C2CC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C12H13FO2S/c13-9-3-4-11-10(8-1-2-8)5-6-16(14,15)12(11)7-9/h3-4,7-8,10H,1-2,5-6H2 |
| InChIKey | LCGAHPABZOKLPB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The IUPAC name of 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide (CID 53307620) is 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide.
What is the SMILES notation for 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The canonical SMILES for 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide is O=S1(=O)CCC(C2CC2)c2ccc(F)cc21.
What is the InChIKey of 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The InChIKey is LCGAHPABZOKLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO2S/c13-9-3-4-11-10(8-1-2-8)5-6-16(14,15)12(11)7-9/h3-4,7-8,10H,1-2,5-6H2.
What are the key properties of 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide has a molecular weight of 240.30 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide is sourced from PubChem (CID 53307620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).