C29H28N4O3 — CID 5330765
6-methoxy-18-methyl-3-(2-piperidin-1-ylethyl)-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione (PubChem CID 5330765) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 6-methoxy-18-methyl-3-(2-piperidin-1-ylethyl)-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione.
| Compound Name | 6-methoxy-18-methyl-3-(2-piperidin-1-ylethyl)-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione |
|---|---|
| PubChem CID | 5330765 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 6-methoxy-18-methyl-3-(2-piperidin-1-ylethyl)-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione |
| SMILES | COc1ccc2c3c4c(c5c(ccc6ccn(C)c65)c3n(CCN3CCCCC3)c2c1)C(=O)NC4=O |
| InChI | InChI=1S/C29H28N4O3/c1-31-13-10-17-6-8-20-23(26(17)31)25-24(28(34)30-29(25)35)22-19-9-7-18(36-2)16-21(19)33(27(20)22)15-14-32-11-4-3-5-12-32/h6-10,13,16H,3-5,11-12,14-15H2,1-2H3,(H,30,34,35) |
| InChIKey | MXWSOFYDGPJSQA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|